C13H23N5O5S — CID 175705749
[(2S,5R)-2-[N'-(4-aminocyclohexyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175705749) has the molecular formula C13H23N5O5S and a molecular weight of 361.42 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-(4-aminocyclohexyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-(4-aminocyclohexyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175705749 |
| Molecular Formula | C13H23N5O5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [(2S,5R)-2-[N'-(4-aminocyclohexyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C1CCC(N)CC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H23N5O5S/c14-8-1-3-9(4-2-8)16-12(15)11-6-5-10-7-17(11)13(19)18(10)23-24(20,21)22/h8-11H,1-7,14H2,(H2,15,16)(H,20,21,22)/t8?,9?,10-,11+/m1/s1 |
| InChIKey | MQJZTBPTSPOAGS-LXKPXOPUSA-N |
| XLogP | -0.38 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|