C14H23N5O6S — CID 175705775
[(2S,5R)-2-[N'-(1-acetylpiperidin-4-yl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175705775) has the molecular formula C14H23N5O6S and a molecular weight of 389.43 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-(1-acetylpiperidin-4-yl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-(1-acetylpiperidin-4-yl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175705775 |
| Molecular Formula | C14H23N5O6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [(2S,5R)-2-[N'-(1-acetylpiperidin-4-yl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(=O)N1CCC(/N=C(\N)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C14H23N5O6S/c1-9(20)17-6-4-10(5-7-17)16-13(15)12-3-2-11-8-18(12)14(21)19(11)25-26(22,23)24/h10-12H,2-8H2,1H3,(H2,15,16)(H,22,23,24)/t11-,12+/m1/s1 |
| InChIKey | IZNTYJBESCAYDN-NEPJUHHUSA-N |
| XLogP | -0.64 |
| TPSA | 145.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|