C13H21N5O8S2 — CID 172849366
[(2S,5R)-2-[N'-[(3S)-1-acetylpyrrolidin-3-yl]sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172849366) has the molecular formula C13H21N5O8S2 and a molecular weight of 439.47 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-[(3S)-1-acetylpyrrolidin-3-yl]sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-[(3S)-1-acetylpyrrolidin-3-yl]sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172849366 |
| Molecular Formula | C13H21N5O8S2 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [(2S,5R)-2-[N'-[(3S)-1-acetylpyrrolidin-3-yl]sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(=O)N1CC[C@H](S(=O)(=O)N=C(N)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H21N5O8S2/c1-8(19)16-5-4-10(7-16)27(21,22)15-12(14)11-3-2-9-6-17(11)13(20)18(9)26-28(23,24)25/h9-11H,2-7H2,1H3,(H2,14,15)(H,23,24,25)/t9-,10+,11+/m1/s1 |
| InChIKey | XVYPMTGZPUGNPF-VWYCJHECSA-N |
| XLogP | -1.70 |
| TPSA | 179.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|