C14H22N4O7S — CID 134260566
[(2S,5R)-2-[(1-acetylpiperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 134260566) has the molecular formula C14H22N4O7S and a molecular weight of 390.42 g/mol. Its IUPAC name is [(2S,5R)-2-[(1-acetylpiperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[(1-acetylpiperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 134260566 |
| Molecular Formula | C14H22N4O7S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(2S,5R)-2-[(1-acetylpiperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(=O)N1CCC(NC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C14H22N4O7S/c1-9(19)16-6-4-10(5-7-16)15-13(20)12-3-2-11-8-17(12)14(21)18(11)25-26(22,23)24/h10-12H,2-8H2,1H3,(H,15,20)(H,22,23,24)/t11-,12+/m1/s1 |
| InChIKey | FBPFAUZZUVSIKU-NEPJUHHUSA-N |
| XLogP | -0.88 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|