C13H20BN4O7S — CID 58529987
CID 58529987 (PubChem CID 58529987) has the molecular formula C13H20BN4O7S and a molecular weight of 387.20 g/mol.
| Compound Name | CID 58529987 |
|---|---|
| PubChem CID | 58529987 |
| Molecular Formula | C13H20BN4O7S |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | — |
| SMILES | O=C[B]N1CCC(NC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C13H20BN4O7S/c19-8-14-16-5-3-9(4-6-16)15-12(20)11-2-1-10-7-17(11)13(21)18(10)25-26(22,23)24/h8-11H,1-7H2,(H,15,20)(H,22,23,24)/t10-,11+/m1/s1 |
| InChIKey | PUQYYHQZKGXNBW-MNOVXSKESA-N |
| XLogP | -1.62 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|