C13H20N4O9S2 — CID 71724636
[(2R,5S)-2-[[(1,1-dioxothiane-4-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71724636) has the molecular formula C13H20N4O9S2 and a molecular weight of 440.46 g/mol. Its IUPAC name is [(2R,5S)-2-[[(1,1-dioxothiane-4-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-[[(1,1-dioxothiane-4-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71724636 |
| Molecular Formula | C13H20N4O9S2 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [(2R,5S)-2-[[(1,1-dioxothiane-4-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)[C@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H20N4O9S2/c18-11(8-3-5-27(21,22)6-4-8)14-15-12(19)10-2-1-9-7-16(10)13(20)17(9)26-28(23,24)25/h8-10H,1-7H2,(H,14,18)(H,15,19)(H,23,24,25)/t9-,10+/m0/s1 |
| InChIKey | QPTOATWEUYRAOP-VHSXEESVSA-N |
| XLogP | -2.04 |
| TPSA | 179.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|