C13H21N5O7S — CID 90221112
[2-[[(1-methylpyrrolidine-2-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90221112) has the molecular formula C13H21N5O7S and a molecular weight of 391.41 g/mol. Its IUPAC name is [2-[[(1-methylpyrrolidine-2-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[(1-methylpyrrolidine-2-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90221112 |
| Molecular Formula | C13H21N5O7S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [2-[[(1-methylpyrrolidine-2-carbonyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN1CCCC1C(=O)NNC(=O)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H21N5O7S/c1-16-6-2-3-9(16)11(19)14-15-12(20)10-5-4-8-7-17(10)13(21)18(8)25-26(22,23)24/h8-10H,2-7H2,1H3,(H,14,19)(H,15,20)(H,22,23,24) |
| InChIKey | CXKYMIUILHGPKT-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|