C18H29N5O9S — CID 71285542
tert-butyl (3R)-3-[[[(2R,5S)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 71285542) has the molecular formula C18H29N5O9S and a molecular weight of 491.52 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[[(2R,5S)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[[(2R,5S)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71285542 |
| Molecular Formula | C18H29N5O9S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | tert-butyl (3R)-3-[[[(2R,5S)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C(=O)NNC(=O)[C@H]2CC[C@H]3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C18H29N5O9S/c1-18(2,3)31-17(27)21-8-4-5-11(9-21)14(24)19-20-15(25)13-7-6-12-10-22(13)16(26)23(12)32-33(28,29)30/h11-13H,4-10H2,1-3H3,(H,19,24)(H,20,25)(H,28,29,30)/t11-,12+,13-/m1/s1 |
| InChIKey | WRULADJMDRCIFB-FRRDWIJNSA-N |
| XLogP | -0.22 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|