C12H19N5O7S — CID 141465927
[(2R,5R)-7-oxo-2-[(pyrrolidine-1-carbonylamino)carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 141465927) has the molecular formula C12H19N5O7S and a molecular weight of 377.38 g/mol. Its IUPAC name is [(2R,5R)-7-oxo-2-[(pyrrolidine-1-carbonylamino)carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5R)-7-oxo-2-[(pyrrolidine-1-carbonylamino)carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 141465927 |
| Molecular Formula | C12H19N5O7S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | [(2R,5R)-7-oxo-2-[(pyrrolidine-1-carbonylamino)carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)N1CCCC1)[C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H19N5O7S/c18-10(13-14-11(19)15-5-1-2-6-15)9-4-3-8-7-16(9)12(20)17(8)24-25(21,22)23/h8-9H,1-7H2,(H,13,18)(H,14,19)(H,21,22,23)/t8-,9-/m1/s1 |
| InChIKey | GSHJUFCGOVFWMM-RKDXNWHRSA-N |
| XLogP | -1.17 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|