C11H17N3O7S — CID 71724821
[(2R,5S)-2-(cyclobutyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71724821) has the molecular formula C11H17N3O7S and a molecular weight of 335.34 g/mol. Its IUPAC name is [(2R,5S)-2-(cyclobutyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-(cyclobutyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71724821 |
| Molecular Formula | C11H17N3O7S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [(2R,5S)-2-(cyclobutyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC1CCC1)[C@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H17N3O7S/c15-10(12-20-8-2-1-3-8)9-5-4-7-6-13(9)11(16)14(7)21-22(17,18)19/h7-9H,1-6H2,(H,12,15)(H,17,18,19)/t7-,9+/m0/s1 |
| InChIKey | XSWCBEHWKIZRGA-IONNQARKSA-N |
| XLogP | -0.41 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|