C13H21N5O7S — CID 78159491
[2-[(1-ethanimidoylpyrrolidin-3-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 78159491) has the molecular formula C13H21N5O7S and a molecular weight of 391.41 g/mol. Its IUPAC name is [2-[(1-ethanimidoylpyrrolidin-3-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[(1-ethanimidoylpyrrolidin-3-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 78159491 |
| Molecular Formula | C13H21N5O7S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [2-[(1-ethanimidoylpyrrolidin-3-yl)oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\C)N1CCC(ONC(=O)C2CCC3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H21N5O7S/c1-8(14)16-5-4-10(7-16)24-15-12(19)11-3-2-9-6-17(11)13(20)18(9)25-26(21,22)23/h9-11,14H,2-7H2,1H3,(H,15,19)(H,21,22,23)/b14-8+ |
| InChIKey | TZYKOVWOBRBDLZ-RIYZIHGNSA-N |
| XLogP | -0.89 |
| TPSA | 152.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|