C15H26N4O7S — CID 140619789
[2-[[4-(dimethylamino)cyclohexyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 140619789) has the molecular formula C15H26N4O7S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)cyclohexyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[4-(dimethylamino)cyclohexyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140619789 |
| Molecular Formula | C15H26N4O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [2-[[4-(dimethylamino)cyclohexyl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN(C)C1CCC(ONC(=O)C2CCC3CN2C(=O)N3OS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C15H26N4O7S/c1-17(2)10-3-6-12(7-4-10)25-16-14(20)13-8-5-11-9-18(13)15(21)19(11)26-27(22,23)24/h10-13H,3-9H2,1-2H3,(H,16,20)(H,22,23,24) |
| InChIKey | QRFXJPRXBVYIAW-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|