C11H18N4O8S — CID 140696516
[2-[[2-(dimethylamino)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 140696516) has the molecular formula C11H18N4O8S and a molecular weight of 366.35 g/mol. Its IUPAC name is [2-[[2-(dimethylamino)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[2-(dimethylamino)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140696516 |
| Molecular Formula | C11H18N4O8S |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [2-[[2-(dimethylamino)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN(C)C(=O)CONC(=O)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H18N4O8S/c1-13(2)9(16)6-22-12-10(17)8-4-3-7-5-14(8)11(18)15(7)23-24(19,20)21/h7-8H,3-6H2,1-2H3,(H,12,17)(H,19,20,21) |
| InChIKey | LQVYHBXOAOKXIA-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|