C14H23N5O8S — CID 140696526
[2-[[2-(1,4-diazepan-1-yl)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 140696526) has the molecular formula C14H23N5O8S and a molecular weight of 421.43 g/mol. Its IUPAC name is [2-[[2-(1,4-diazepan-1-yl)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[2-(1,4-diazepan-1-yl)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140696526 |
| Molecular Formula | C14H23N5O8S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [2-[[2-(1,4-diazepan-1-yl)-2-oxoethoxy]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOCC(=O)N1CCCNCC1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H23N5O8S/c20-12(17-6-1-4-15-5-7-17)9-26-16-13(21)11-3-2-10-8-18(11)14(22)19(10)27-28(23,24)25/h10-11,15H,1-9H2,(H,16,21)(H,23,24,25) |
| InChIKey | LPFXROKTTQLSBP-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 157.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|