C17H30N6O7S — CID 166047299
[7-oxo-2-[[(2S,4S)-4-(piperazin-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 166047299) has the molecular formula C17H30N6O7S and a molecular weight of 462.53 g/mol. Its IUPAC name is [7-oxo-2-[[(2S,4S)-4-(piperazin-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-[[(2S,4S)-4-(piperazin-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 166047299 |
| Molecular Formula | C17H30N6O7S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [7-oxo-2-[[(2S,4S)-4-(piperazin-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC[C@@H]1C[C@H](CN2CCNCC2)CN1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C17H30N6O7S/c24-16(15-2-1-14-10-22(15)17(25)23(14)30-31(26,27)28)20-29-11-13-7-12(8-19-13)9-21-5-3-18-4-6-21/h12-15,18-19H,1-11H2,(H,20,24)(H,26,27,28)/t12-,13-,14?,15?/m0/s1 |
| InChIKey | WERGLZDEODWVIP-HESLUPGFSA-N |
| XLogP | -2.08 |
| TPSA | 152.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|