C13H21ClN4O7S — CID 166047263
[2-[[(2S,4R)-4-(chloromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 166047263) has the molecular formula C13H21ClN4O7S and a molecular weight of 412.85 g/mol. Its IUPAC name is [2-[[(2S,4R)-4-(chloromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[(2S,4R)-4-(chloromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 166047263 |
| Molecular Formula | C13H21ClN4O7S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [2-[[(2S,4R)-4-(chloromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC[C@@H]1C[C@@H](CCl)CN1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H21ClN4O7S/c14-4-8-3-9(15-5-8)7-24-16-12(19)11-2-1-10-6-17(11)13(20)18(10)25-26(21,22)23/h8-11,15H,1-7H2,(H,16,19)(H,21,22,23)/t8-,9-,10?,11?/m0/s1 |
| InChIKey | DYYJIBMOUZJOGX-SAAXCQNUSA-N |
| XLogP | -0.75 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|