C16H22N6O7S — CID 167313985
[2-[[(2S,4S)-4-[(1S)-1,2-dicyanoethyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 167313985) has the molecular formula C16H22N6O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is [2-[[(2S,4S)-4-[(1S)-1,2-dicyanoethyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[(2S,4S)-4-[(1S)-1,2-dicyanoethyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 167313985 |
| Molecular Formula | C16H22N6O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [2-[[(2S,4S)-4-[(1S)-1,2-dicyanoethyl]pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N#CC[C@H](C#N)[C@H]1CN[C@H](CONC(=O)C2CCC3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C16H22N6O7S/c17-4-3-10(6-18)11-5-12(19-7-11)9-28-20-15(23)14-2-1-13-8-21(14)16(24)22(13)29-30(25,26)27/h10-14,19H,1-3,5,7-9H2,(H,20,23)(H,25,26,27)/t10-,11-,12+,13?,14?/m1/s1 |
| InChIKey | WPYXUIQWHPVHLA-BFKVFCTQSA-N |
| XLogP | -0.93 |
| TPSA | 185.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|