C14H21N5O7S — CID 166047274
[2-[[(2R,4S)-4-(cyanomethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 166047274) has the molecular formula C14H21N5O7S and a molecular weight of 403.42 g/mol. Its IUPAC name is [2-[[(2R,4S)-4-(cyanomethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[[(2R,4S)-4-(cyanomethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 166047274 |
| Molecular Formula | C14H21N5O7S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-[[(2R,4S)-4-(cyanomethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N#CC[C@H]1CN[C@@H](CONC(=O)C2CCC3CN2C(=O)N3OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C14H21N5O7S/c15-4-3-9-5-10(16-6-9)8-25-17-13(20)12-2-1-11-7-18(12)14(21)19(11)26-27(22,23)24/h9-12,16H,1-3,5-8H2,(H,17,20)(H,22,23,24)/t9-,10-,11?,12?/m1/s1 |
| InChIKey | CDTBQHBTZGTUED-QYNFOATHSA-N |
| XLogP | -1.07 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|