C17H29N5O7S2 — CID 172768635
[(2S,5R)-7-oxo-2-[[(2R,4R)-4-(thiomorpholin-1-ium-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 172768635) has the molecular formula C17H29N5O7S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-[[(2R,4R)-4-(thiomorpholin-1-ium-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-[[(2R,4R)-4-(thiomorpholin-1-ium-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 172768635 |
| Molecular Formula | C17H29N5O7S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | [(2S,5R)-7-oxo-2-[[(2R,4R)-4-(thiomorpholin-1-ium-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C(NOC[C@H]1C[C@@H](C[S+]2CCNCC2)CN1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H29N5O7S2/c23-16(15-2-1-14-9-21(15)17(24)22(14)29-31(25,26)27)20-28-10-13-7-12(8-19-13)11-30-5-3-18-4-6-30/h12-15,18-19H,1-11H2,(H-,20,23,25,26,27)/t12-,13-,14-,15+/m1/s1 |
| InChIKey | MQPUIXHRTLRIQE-TUVASFSCSA-N |
| XLogP | -2.11 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|