C14H20N7NaO7S — CID 162052922
sodium [(2S,5R)-7-oxo-2-[[(2S,4S)-4-(triazol-2-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 162052922) has the molecular formula C14H20N7NaO7S and a molecular weight of 453.41 g/mol. Its IUPAC name is sodium [(2S,5R)-7-oxo-2-[[(2S,4S)-4-(triazol-2-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-7-oxo-2-[[(2S,4S)-4-(triazol-2-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 162052922 |
| Molecular Formula | C14H20N7NaO7S |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | sodium [(2S,5R)-7-oxo-2-[[(2S,4S)-4-(triazol-2-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C(NOC[C@@H]1C[C@H](n2nccn2)CN1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H21N7O7S.Na/c22-13(18-27-8-9-5-11(6-15-9)21-16-3-4-17-21)12-2-1-10-7-19(12)14(23)20(10)28-29(24,25)26;/h3-4,9-12,15H,1-2,5-8H2,(H,18,22)(H,24,25,26);/q;+1/p-1/t9-,10+,11-,12-;/m0./s1 |
| InChIKey | DUWWJSDDPSMSEW-WWYGBNOYSA-M |
| XLogP | -5.11 |
| TPSA | 171.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|