C13H22N4O7S2 — CID 166047234
[7-oxo-2-[[(2R,4S)-4-(sulfanylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 166047234) has the molecular formula C13H22N4O7S2 and a molecular weight of 410.47 g/mol. Its IUPAC name is [7-oxo-2-[[(2R,4S)-4-(sulfanylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-[[(2R,4S)-4-(sulfanylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 166047234 |
| Molecular Formula | C13H22N4O7S2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [7-oxo-2-[[(2R,4S)-4-(sulfanylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC[C@H]1C[C@H](CS)CN1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H22N4O7S2/c18-12(15-23-6-9-3-8(7-25)4-14-9)11-2-1-10-5-16(11)13(19)17(10)24-26(20,21)22/h8-11,14,25H,1-7H2,(H,15,18)(H,20,21,22)/t8-,9+,10?,11?/m0/s1 |
| InChIKey | BXLYXHUMTWFZQD-IZUQBHJASA-N |
| XLogP | -1.05 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|