C12H18N4O8S — CID 73387990
[(2S,5R)-7-oxo-2-[[(2S)-5-oxopyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 73387990) has the molecular formula C12H18N4O8S and a molecular weight of 378.36 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-[[(2S)-5-oxopyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-[[(2S)-5-oxopyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 73387990 |
| Molecular Formula | C12H18N4O8S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [(2S,5R)-7-oxo-2-[[(2S)-5-oxopyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C1CC[C@@H](CONC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)N1 |
| InChI | InChI=1S/C12H18N4O8S/c17-10-4-1-7(13-10)6-23-14-11(18)9-3-2-8-5-15(9)12(19)16(8)24-25(20,21)22/h7-9H,1-6H2,(H,13,17)(H,14,18)(H,20,21,22)/t7-,8+,9-/m0/s1 |
| InChIKey | SQRSZRIGFAKYLQ-YIZRAAEISA-N |
| XLogP | -1.68 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|