C14H21N7O7S — CID 129216909
[(2S,5R)-7-oxo-2-[[(2R,4R)-4-(triazol-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 129216909) has the molecular formula C14H21N7O7S and a molecular weight of 431.43 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-[[(2R,4R)-4-(triazol-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-[[(2R,4R)-4-(triazol-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 129216909 |
| Molecular Formula | C14H21N7O7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [(2S,5R)-7-oxo-2-[[(2R,4R)-4-(triazol-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC[C@H]1C[C@@H](n2ccnn2)CN1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H21N7O7S/c22-13(17-27-8-9-5-11(6-15-9)20-4-3-16-18-20)12-2-1-10-7-19(12)14(23)21(10)28-29(24,25)26/h3-4,9-12,15H,1-2,5-8H2,(H,17,22)(H,24,25,26)/t9-,10-,11-,12+/m1/s1 |
| InChIKey | QKRAOHCPISGVES-KKOKHZNYSA-N |
| XLogP | -1.77 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|