C19H30F3N5O10S — CID 162318351
[(2S,5R)-2-[[(2R,4R)-4-(4-hydroxypiperidin-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid (PubChem CID 162318351) has the molecular formula C19H30F3N5O10S and a molecular weight of 577.54 g/mol. Its IUPAC name is [(2S,5R)-2-[[(2R,4R)-4-(4-hydroxypiperidin-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,5R)-2-[[(2R,4R)-4-(4-hydroxypiperidin-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162318351 |
| Molecular Formula | C19H30F3N5O10S |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | [(2S,5R)-2-[[(2R,4R)-4-(4-hydroxypiperidin-1-yl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NOC[C@H]1C[C@@H](N2CCC(O)CC2)CN1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H29N5O8S.C2HF3O2/c23-14-3-5-20(6-4-14)13-7-11(18-8-13)10-29-19-16(24)15-2-1-12-9-21(15)17(25)22(12)30-31(26,27)28;3-2(4,5)1(6)7/h11-15,18,23H,1-10H2,(H,19,24)(H,26,27,28);(H,6,7)/t11-,12-,13-,15+;/m1./s1 |
| InChIKey | KYLINJCQIQQKFA-WKSMOURSSA-N |
| XLogP | -1.14 |
| TPSA | 198.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|