C13H20FN4O6S- — CID 164852180
[2-[[(2R,4S)-4-(fluoromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite (PubChem CID 164852180) has the molecular formula C13H20FN4O6S- and a molecular weight of 379.39 g/mol. Its IUPAC name is [2-[[(2R,4S)-4-(fluoromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite.
| Compound Name | [2-[[(2R,4S)-4-(fluoromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite |
|---|---|
| PubChem CID | 164852180 |
| Molecular Formula | C13H20FN4O6S- |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [2-[[(2R,4S)-4-(fluoromethyl)pyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite |
| SMILES | O=C(NOC[C@H]1C[C@H](CF)CN1)C1CCC2CN1C(=O)N2OS(=O)[O-] |
| InChI | InChI=1S/C13H21FN4O6S/c14-4-8-3-9(15-5-8)7-23-16-12(19)11-2-1-10-6-17(11)13(20)18(10)24-25(21)22/h8-11,15H,1-7H2,(H,16,19)(H,21,22)/p-1/t8-,9-,10?,11?/m1/s1 |
| InChIKey | HTQIXFNOESNYMY-NKVNRFPTSA-M |
| XLogP | -1.02 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|