C14H21N8O6S- — CID 164852194
[7-oxo-2-[[(2R,4R)-4-(tetrazol-2-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite (PubChem CID 164852194) has the molecular formula C14H21N8O6S- and a molecular weight of 429.44 g/mol. Its IUPAC name is [7-oxo-2-[[(2R,4R)-4-(tetrazol-2-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite.
| Compound Name | [7-oxo-2-[[(2R,4R)-4-(tetrazol-2-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite |
|---|---|
| PubChem CID | 164852194 |
| Molecular Formula | C14H21N8O6S- |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [7-oxo-2-[[(2R,4R)-4-(tetrazol-2-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite |
| SMILES | O=C(NOC[C@H]1C[C@@H](Cn2ncnn2)CN1)C1CCC2CN1C(=O)N2OS(=O)[O-] |
| InChI | InChI=1S/C14H22N8O6S/c23-13(12-2-1-11-6-20(12)14(24)22(11)28-29(25)26)18-27-7-10-3-9(4-15-10)5-21-17-8-16-19-21/h8-12,15H,1-7H2,(H,18,23)(H,25,26)/p-1/t9-,10-,11?,12?/m1/s1 |
| InChIKey | LTFPVZUQWZPQRS-QYNFOATHSA-M |
| XLogP | -2.31 |
| TPSA | 166.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|