C13H22N4O6S — CID 164852251
[2-[[(2S,4R)-4-methylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite (PubChem CID 164852251) has the molecular formula C13H22N4O6S and a molecular weight of 362.41 g/mol. Its IUPAC name is [2-[[(2S,4R)-4-methylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite.
| Compound Name | [2-[[(2S,4R)-4-methylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite |
|---|---|
| PubChem CID | 164852251 |
| Molecular Formula | C13H22N4O6S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [2-[[(2S,4R)-4-methylpyrrolidin-2-yl]methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite |
| SMILES | C[C@H]1CN[C@H](CONC(=O)C2CCC3CN2C(=O)N3OS(=O)O)C1 |
| InChI | InChI=1S/C13H22N4O6S/c1-8-4-9(14-5-8)7-22-15-12(18)11-3-2-10-6-16(11)13(19)17(10)23-24(20)21/h8-11,14H,2-7H2,1H3,(H,15,18)(H,20,21)/t8-,9+,10?,11?/m1/s1 |
| InChIKey | HIIPBSHVMWJPJD-MFQSTILNSA-N |
| XLogP | -0.63 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|