C15H23N7O6S — CID 164852261
[7-oxo-2-[[(2S,4S)-4-(1,2,4-triazol-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite (PubChem CID 164852261) has the molecular formula C15H23N7O6S and a molecular weight of 429.46 g/mol. Its IUPAC name is [7-oxo-2-[[(2S,4S)-4-(1,2,4-triazol-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite.
| Compound Name | [7-oxo-2-[[(2S,4S)-4-(1,2,4-triazol-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite |
|---|---|
| PubChem CID | 164852261 |
| Molecular Formula | C15H23N7O6S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [7-oxo-2-[[(2S,4S)-4-(1,2,4-triazol-1-ylmethyl)pyrrolidin-2-yl]methoxycarbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite |
| SMILES | O=C(NOC[C@@H]1C[C@H](Cn2cncn2)CN1)C1CCC2CN1C(=O)N2OS(=O)O |
| InChI | InChI=1S/C15H23N7O6S/c23-14(13-2-1-12-6-21(13)15(24)22(12)28-29(25)26)19-27-7-11-3-10(4-17-11)5-20-9-16-8-18-20/h8-13,17H,1-7H2,(H,19,23)(H,25,26)/t10-,11-,12?,13?/m0/s1 |
| InChIKey | SNGMAPALCGOCJR-ZSVAQUKISA-N |
| XLogP | -1.36 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|