C11H18N4NaO8S — CID 161036742
CID 161036742 (PubChem CID 161036742) has the molecular formula C11H18N4NaO8S and a molecular weight of 389.34 g/mol.
| Compound Name | CID 161036742 |
|---|---|
| PubChem CID | 161036742 |
| Molecular Formula | C11H18N4NaO8S |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | — |
| SMILES | CN(C)C(=O)CONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O.[Na] |
| InChI | InChI=1S/C11H18N4O8S.Na/c1-13(2)9(16)6-22-12-10(17)8-4-3-7-5-14(8)11(18)15(7)23-24(19,20)21;/h7-8H,3-6H2,1-2H3,(H,12,17)(H,19,20,21);/t7-,8+;/m1./s1 |
| InChIKey | UAISIOCNLNXTSS-WLYNEOFISA-N |
| XLogP | -2.26 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|