C16H28N4O9S — CID 118073928
3,3-dimethylbutyl-[2-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid (PubChem CID 118073928) has the molecular formula C16H28N4O9S and a molecular weight of 452.49 g/mol. Its IUPAC name is 3,3-dimethylbutyl-[2-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid.
| Compound Name | 3,3-dimethylbutyl-[2-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid |
|---|---|
| PubChem CID | 118073928 |
| Molecular Formula | C16H28N4O9S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 3,3-dimethylbutyl-[2-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]carbamic acid |
| SMILES | CC(C)(C)CCN(CCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C16H28N4O9S/c1-16(2,3)6-7-18(15(23)24)8-9-28-17-13(21)12-5-4-11-10-19(12)14(22)20(11)29-30(25,26)27/h11-12H,4-10H2,1-3H3,(H,17,21)(H,23,24)(H,25,26,27)/t11-,12+/m1/s1 |
| InChIKey | KKSSRWAYXOXYFH-NEPJUHHUSA-N |
| XLogP | 0.45 |
| TPSA | 166.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|