C32H63N5O9S — CID 118073923
tetrabutylazanium;N-[3,4,4-trimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate (PubChem CID 118073923) has the molecular formula C32H63N5O9S and a molecular weight of 693.95 g/mol. Its IUPAC name is tetrabutylazanium;N-[3,4,4-trimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate.
| Compound Name | tetrabutylazanium;N-[3,4,4-trimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate |
|---|---|
| PubChem CID | 118073923 |
| Molecular Formula | C32H63N5O9S |
| Molecular Weight | 693.95 g/mol |
| Exact Mass | 693.43 |
| IUPAC Name | tetrabutylazanium;N-[3,4,4-trimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate |
| SMILES | CC(C)(C)C(C)(CCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)NC(=O)[O-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H28N4O9S.C16H36N/c1-15(2,3)16(4,17-13(22)23)7-8-28-18-12(21)11-6-5-10-9-19(11)14(24)20(10)29-30(25,26)27;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h10-11,17H,5-9H2,1-4H3,(H,18,21)(H,22,23)(H,25,26,27);5-16H2,1-4H3/q;+1/p-1/t10-,11+,16?;/m1./s1 |
| InChIKey | YSOWJQMAGUMRLG-UWMPHGOYSA-M |
| XLogP | 4.17 |
| TPSA | 177.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.95 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|