C31H61N5O9S — CID 118073858
N-[4,4-dimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate;tetrabutylazanium (PubChem CID 118073858) has the molecular formula C31H61N5O9S and a molecular weight of 679.92 g/mol. Its IUPAC name is N-[4,4-dimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate;tetrabutylazanium.
| Compound Name | N-[4,4-dimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate;tetrabutylazanium |
|---|---|
| PubChem CID | 118073858 |
| Molecular Formula | C31H61N5O9S |
| Molecular Weight | 679.92 g/mol |
| Exact Mass | 679.42 |
| IUPAC Name | N-[4,4-dimethyl-1-[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxypentan-3-yl]carbamate;tetrabutylazanium |
| SMILES | CC(C)(C)C(CCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)NC(=O)[O-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C15H26N4O9S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-15(2,3)11(16-13(21)22)6-7-27-17-12(20)10-5-4-9-8-18(10)14(23)19(9)28-29(24,25)26/h5-16H2,1-4H3;9-11,16H,4-8H2,1-3H3,(H,17,20)(H,21,22)(H,24,25,26)/q+1;/p-1/t;9-,10+,11?/m.1/s1 |
| InChIKey | HWHOJGNZEVMYEH-FKPDCJQKSA-M |
| XLogP | 3.78 |
| TPSA | 177.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|