C10H16N8O7S — CID 129117422
[2-[2-(5-aminotetrazol-1-yl)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 129117422) has the molecular formula C10H16N8O7S and a molecular weight of 392.35 g/mol. Its IUPAC name is [2-[2-(5-aminotetrazol-1-yl)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[2-(5-aminotetrazol-1-yl)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 129117422 |
| Molecular Formula | C10H16N8O7S |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [2-[2-(5-aminotetrazol-1-yl)ethoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Nc1nnnn1CCONC(=O)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H16N8O7S/c11-9-12-14-15-17(9)3-4-24-13-8(19)7-2-1-6-5-16(7)10(20)18(6)25-26(21,22)23/h6-7H,1-5H2,(H,13,19)(H2,11,12,15)(H,21,22,23) |
| InChIKey | XWKUHXCNDPSQPV-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|