C12H17N5O7S — CID 90320567
[(2S)-2-[(1-methylpyrazol-3-yl)methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90320567) has the molecular formula C12H17N5O7S and a molecular weight of 375.36 g/mol. Its IUPAC name is [(2S)-2-[(1-methylpyrazol-3-yl)methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-2-[(1-methylpyrazol-3-yl)methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90320567 |
| Molecular Formula | C12H17N5O7S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [(2S)-2-[(1-methylpyrazol-3-yl)methoxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Cn1ccc(CONC(=O)[C@@H]2CCC3CN2C(=O)N3OS(=O)(=O)O)n1 |
| InChI | InChI=1S/C12H17N5O7S/c1-15-5-4-8(13-15)7-23-14-11(18)10-3-2-9-6-16(10)12(19)17(9)24-25(20,21)22/h4-5,9-10H,2-3,6-7H2,1H3,(H,14,18)(H,20,21,22)/t9?,10-/m0/s1 |
| InChIKey | KTRSVLLMXMNNRB-AXDSSHIGSA-N |
| XLogP | -1.03 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|