C10H16N4O7S — CID 90220079
[2-(azetidin-3-yloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90220079) has the molecular formula C10H16N4O7S and a molecular weight of 336.33 g/mol. Its IUPAC name is [2-(azetidin-3-yloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-(azetidin-3-yloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90220079 |
| Molecular Formula | C10H16N4O7S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [2-(azetidin-3-yloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC1CNC1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H16N4O7S/c15-9(12-20-7-3-11-4-7)8-2-1-6-5-13(8)10(16)14(6)21-22(17,18)19/h6-8,11H,1-5H2,(H,12,15)(H,17,18,19) |
| InChIKey | BJPNRZKNAXWNJI-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|