C12H19N5O8S — CID 90228681
[(2S)-2-[[(4E)-4-methoxyiminopyrrolidin-3-yl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90228681) has the molecular formula C12H19N5O8S and a molecular weight of 393.38 g/mol. Its IUPAC name is [(2S)-2-[[(4E)-4-methoxyiminopyrrolidin-3-yl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-2-[[(4E)-4-methoxyiminopyrrolidin-3-yl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90228681 |
| Molecular Formula | C12H19N5O8S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | [(2S)-2-[[(4E)-4-methoxyiminopyrrolidin-3-yl]oxycarbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CO/N=C1\CNCC1ONC(=O)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H19N5O8S/c1-23-14-8-4-13-5-10(8)24-15-11(18)9-3-2-7-6-16(9)12(19)17(7)25-26(20,21)22/h7,9-10,13H,2-6H2,1H3,(H,15,18)(H,20,21,22)/b14-8+/t7?,9-,10?/m0/s1 |
| InChIKey | OPCKTZLMPPWHLP-XHCCUQBNSA-N |
| XLogP | -1.99 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|