C15H23N3O7S — CID 135242993
[(2S,5R)-2-(3-bicyclo[3.2.1]octanyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 135242993) has the molecular formula C15H23N3O7S and a molecular weight of 389.43 g/mol. Its IUPAC name is [(2S,5R)-2-(3-bicyclo[3.2.1]octanyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-(3-bicyclo[3.2.1]octanyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135242993 |
| Molecular Formula | C15H23N3O7S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [(2S,5R)-2-(3-bicyclo[3.2.1]octanyloxycarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC1CC2CCC(C2)C1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H23N3O7S/c19-14(16-24-12-6-9-1-2-10(5-9)7-12)13-4-3-11-8-17(13)15(20)18(11)25-26(21,22)23/h9-13H,1-8H2,(H,16,19)(H,21,22,23)/t9?,10?,11-,12?,13+/m1/s1 |
| InChIKey | IEKSYZWIKSZAHF-KBNBOOKPSA-N |
| XLogP | 0.62 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|