C13H20N4O6S — CID 74942934
[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 74942934) has the molecular formula C13H20N4O6S and a molecular weight of 360.39 g/mol. Its IUPAC name is [2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 74942934 |
| Molecular Formula | C13H20N4O6S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(C1CCC2CN1C(=O)N2OS(=O)(=O)O)N1CC2CNCC2C1 |
| InChI | InChI=1S/C13H20N4O6S/c18-12(15-5-8-3-14-4-9(8)6-15)11-2-1-10-7-16(11)13(19)17(10)23-24(20,21)22/h8-11,14H,1-7H2,(H,20,21,22) |
| InChIKey | HAUNXFWIZFSLID-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|