C12H20N6O7S — CID 71548082
[(2S,5S)-7-oxo-2-[[[(2R)-piperazine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71548082) has the molecular formula C12H20N6O7S and a molecular weight of 392.39 g/mol. Its IUPAC name is [(2S,5S)-7-oxo-2-[[[(2R)-piperazine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5S)-7-oxo-2-[[[(2R)-piperazine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71548082 |
| Molecular Formula | C12H20N6O7S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [(2S,5S)-7-oxo-2-[[[(2R)-piperazine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)[C@@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O)[C@H]1CNCCN1 |
| InChI | InChI=1S/C12H20N6O7S/c19-10(8-5-13-3-4-14-8)15-16-11(20)9-2-1-7-6-17(9)12(21)18(7)25-26(22,23)24/h7-9,13-14H,1-6H2,(H,15,19)(H,16,20)(H,22,23,24)/t7-,8+,9-/m0/s1 |
| InChIKey | LWYXLHNUGVSRPF-YIZRAAEISA-N |
| XLogP | -3.30 |
| TPSA | 169.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|