C14H23N5O7S — CID 90228580
[(2S)-7-oxo-2-[[(2-piperidin-2-ylacetyl)amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90228580) has the molecular formula C14H23N5O7S and a molecular weight of 405.43 g/mol. Its IUPAC name is [(2S)-7-oxo-2-[[(2-piperidin-2-ylacetyl)amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-7-oxo-2-[[(2-piperidin-2-ylacetyl)amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90228580 |
| Molecular Formula | C14H23N5O7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [(2S)-7-oxo-2-[[(2-piperidin-2-ylacetyl)amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(CC1CCCCN1)NNC(=O)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H23N5O7S/c20-12(7-9-3-1-2-6-15-9)16-17-13(21)11-5-4-10-8-18(11)14(22)19(10)26-27(23,24)25/h9-11,15H,1-8H2,(H,16,20)(H,17,21)(H,23,24,25)/t9?,10?,11-/m0/s1 |
| InChIKey | XSFMQEIBOQPGFD-ILDUYXDCSA-N |
| XLogP | -1.33 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|