C15H21N7O7S — CID 129228097
[(2S)-7-oxo-2-[[[(4R)-4-pyrazol-1-ylpyrrolidine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 129228097) has the molecular formula C15H21N7O7S and a molecular weight of 443.44 g/mol. Its IUPAC name is [(2S)-7-oxo-2-[[[(4R)-4-pyrazol-1-ylpyrrolidine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-7-oxo-2-[[[(4R)-4-pyrazol-1-ylpyrrolidine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 129228097 |
| Molecular Formula | C15H21N7O7S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | [(2S)-7-oxo-2-[[[(4R)-4-pyrazol-1-ylpyrrolidine-2-carbonyl]amino]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(NNC(=O)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O)C1C[C@@H](n2cccn2)CN1 |
| InChI | InChI=1S/C15H21N7O7S/c23-13(11-6-10(7-16-11)21-5-1-4-17-21)18-19-14(24)12-3-2-9-8-20(12)15(25)22(9)29-30(26,27)28/h1,4-5,9-12,16H,2-3,6-8H2,(H,18,23)(H,19,24)(H,26,27,28)/t9?,10-,11?,12+/m1/s1 |
| InChIKey | VLNJEAXAIQAUCI-RSJDFQLWSA-N |
| XLogP | -2.06 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|