C13H22N4O6S — CID 122196755
[(2S,5S)-2-[methyl(piperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 122196755) has the molecular formula C13H22N4O6S and a molecular weight of 362.41 g/mol. Its IUPAC name is [(2S,5S)-2-[methyl(piperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5S)-2-[methyl(piperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 122196755 |
| Molecular Formula | C13H22N4O6S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(2S,5S)-2-[methyl(piperidin-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN(C(=O)[C@@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O)C1CCNCC1 |
| InChI | InChI=1S/C13H22N4O6S/c1-15(9-4-6-14-7-5-9)12(18)11-3-2-10-8-16(11)13(19)17(10)23-24(20,21)22/h9-11,14H,2-8H2,1H3,(H,20,21,22)/t10-,11-/m0/s1 |
| InChIKey | MUCJIRYYFHQWJE-QWRGUYRKSA-N |
| XLogP | -0.80 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|