C9H11F3N4O7S — CID 140934836
[(2S,5R)-2-[amino-(2,2,2-trifluoroacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 140934836) has the molecular formula C9H11F3N4O7S and a molecular weight of 376.27 g/mol. Its IUPAC name is [(2S,5R)-2-[amino-(2,2,2-trifluoroacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[amino-(2,2,2-trifluoroacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140934836 |
| Molecular Formula | C9H11F3N4O7S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | [(2S,5R)-2-[amino-(2,2,2-trifluoroacetyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NN(C(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3N4O7S/c10-9(11,12)7(18)15(13)6(17)5-2-1-4-3-14(5)8(19)16(4)23-24(20,21)22/h4-5H,1-3,13H2,(H,20,21,22)/t4-,5+/m1/s1 |
| InChIKey | PJXDYZZEOWZQDQ-UHNVWZDZSA-N |
| XLogP | -1.22 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|