C8H8F3N2NaO6S — CID 160657759
sodium [(2S,5R)-7-oxo-2-(2,2,2-trifluoroacetyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 160657759) has the molecular formula C8H8F3N2NaO6S and a molecular weight of 340.21 g/mol. Its IUPAC name is sodium [(2S,5R)-7-oxo-2-(2,2,2-trifluoroacetyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-7-oxo-2-(2,2,2-trifluoroacetyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 160657759 |
| Molecular Formula | C8H8F3N2NaO6S |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | sodium [(2S,5R)-7-oxo-2-(2,2,2-trifluoroacetyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C1N2C[C@@H](CC[C@H]2C(=O)C(F)(F)F)N1OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H9F3N2O6S.Na/c9-8(10,11)6(14)5-2-1-4-3-12(5)7(15)13(4)19-20(16,17)18;/h4-5H,1-3H2,(H,16,17,18);/q;+1/p-1/t4-,5+;/m1./s1 |
| InChIKey | RLGSWJWLRZQPJL-JBUOLDKXSA-M |
| XLogP | -3.22 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|