C7H9N3O9S2-2 — CID 140618621
[(2S,5R)-7-oxo-2-(sulfonatocarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 140618621) has the molecular formula C7H9N3O9S2-2 and a molecular weight of 343.30 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-(sulfonatocarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-(sulfonatocarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 140618621 |
| Molecular Formula | C7H9N3O9S2-2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | [(2S,5R)-7-oxo-2-(sulfonatocarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C(NS(=O)(=O)[O-])[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H11N3O9S2/c11-6(8-20(13,14)15)5-2-1-4-3-9(5)7(12)10(4)19-21(16,17)18/h4-5H,1-3H2,(H,8,11)(H,13,14,15)(H,16,17,18)/p-2/t4-,5+/m1/s1 |
| InChIKey | WTZLNHVVDXYBIK-UHNVWZDZSA-L |
| XLogP | -2.78 |
| TPSA | 176.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|