C10H12N4O6S2 — CID 58530142
[(2S,5R)-7-oxo-2-(1,3-thiazol-2-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 58530142) has the molecular formula C10H12N4O6S2 and a molecular weight of 348.36 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-(1,3-thiazol-2-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-(1,3-thiazol-2-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 58530142 |
| Molecular Formula | C10H12N4O6S2 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | [(2S,5R)-7-oxo-2-(1,3-thiazol-2-ylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(Nc1nccs1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H12N4O6S2/c15-8(12-9-11-3-4-21-9)7-2-1-6-5-13(7)10(16)14(6)20-22(17,18)19/h3-4,6-7H,1-2,5H2,(H,11,12,15)(H,17,18,19)/t6-,7+/m1/s1 |
| InChIKey | COSQMHAARQJIKM-RQJHMYQMSA-N |
| XLogP | 0.08 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|