C15H17N3O7S — CID 149001630
[(2S,5R)-7-oxo-2-(phenacylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 149001630) has the molecular formula C15H17N3O7S and a molecular weight of 383.38 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-(phenacylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-(phenacylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 149001630 |
| Molecular Formula | C15H17N3O7S |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [(2S,5R)-7-oxo-2-(phenacylcarbamoyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(CNC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H17N3O7S/c19-13(10-4-2-1-3-5-10)8-16-14(20)12-7-6-11-9-17(12)15(21)18(11)25-26(22,23)24/h1-5,11-12H,6-9H2,(H,16,20)(H,22,23,24)/t11-,12+/m1/s1 |
| InChIKey | PZTPFEJMMXXIGA-NEPJUHHUSA-N |
| XLogP | -0.01 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|