C15H19N5O7S — CID 71724592
[(2R,5S)-2-[[(2-amino-2-phenylacetyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71724592) has the molecular formula C15H19N5O7S and a molecular weight of 413.41 g/mol. Its IUPAC name is [(2R,5S)-2-[[(2-amino-2-phenylacetyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-[[(2-amino-2-phenylacetyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71724592 |
| Molecular Formula | C15H19N5O7S |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [(2R,5S)-2-[[(2-amino-2-phenylacetyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(C(=O)NNC(=O)[C@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H19N5O7S/c16-12(9-4-2-1-3-5-9)14(22)18-17-13(21)11-7-6-10-8-19(11)15(23)20(10)27-28(24,25)26/h1-5,10-12H,6-8,16H2,(H,17,21)(H,18,22)(H,24,25,26)/t10-,11+,12?/m0/s1 |
| InChIKey | UEAJZYDCWMMLNN-WIKAKEFZSA-N |
| XLogP | -1.16 |
| TPSA | 171.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|