C21H22N4O7S — CID 166570989
[(2S)-2-[[(1R)-2-anilino-2-oxo-1-phenylethyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 166570989) has the molecular formula C21H22N4O7S and a molecular weight of 474.50 g/mol. Its IUPAC name is [(2S)-2-[[(1R)-2-anilino-2-oxo-1-phenylethyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-2-[[(1R)-2-anilino-2-oxo-1-phenylethyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 166570989 |
| Molecular Formula | C21H22N4O7S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [(2S)-2-[[(1R)-2-anilino-2-oxo-1-phenylethyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C(Nc1ccccc1)[C@H](NC(=O)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O7S/c26-19(17-12-11-16-13-24(17)21(28)25(16)32-33(29,30)31)23-18(14-7-3-1-4-8-14)20(27)22-15-9-5-2-6-10-15/h1-10,16-18H,11-13H2,(H,22,27)(H,23,26)(H,29,30,31)/t16?,17-,18+/m0/s1 |
| InChIKey | LNQPGDGVUDAOKH-UQJFVLDMSA-N |
| XLogP | 1.49 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|