C12H15N5O6S — CID 74943094
[2-[(6-amino-2-pyridinyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 74943094) has the molecular formula C12H15N5O6S and a molecular weight of 357.35 g/mol. Its IUPAC name is [2-[(6-amino-2-pyridinyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[(6-amino-2-pyridinyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 74943094 |
| Molecular Formula | C12H15N5O6S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [2-[(6-amino-2-pyridinyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Nc1cccc(NC(=O)C2CCC3CN2C(=O)N3OS(=O)(=O)O)n1 |
| InChI | InChI=1S/C12H15N5O6S/c13-9-2-1-3-10(14-9)15-11(18)8-5-4-7-6-16(8)12(19)17(7)23-24(20,21)22/h1-3,7-8H,4-6H2,(H,20,21,22)(H3,13,14,15,18) |
| InChIKey | MZUXZKDOYICLDH-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|